Loading distributor info...
| Description | K03861 is a type II CDK2 inhibitor with Kd of 50 nM, 18.6 nM, 15.4 nM, and 9.7 nM for CDK2(WT), CDK2(C118L), CDK2(A144C), and CDK2(C118L/A144C), respectlvely. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15889 |
|---|---|
| Formula | C24H26F3N7O2 |
| Molecular Weight | 501.5 |
| CAS Number | 853299-07-7 |
| SMILES | CN1CCN(CC2=C(C(F)(F)F)C=C(/N=C(O)/NC3=CC=C(OC(C=CN4)=NC4=N)C=C3)C=C2)CC1 |
| Synonyms | K 03861, K-03861 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 97 mg/mL (193.42 mM) | |
| Water | Insoluble | ||
| Ethanol | 15 mg/mL (29.91 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.94 mL | 99.7 mL | 199.4 mL |
| 0.5 mM | 3.99 mL | 19.94 mL | 39.88 mL |
| 1 mM | 1.99 mL | 9.97 mL | 19.94 mL |
| 5 mM | 0.4 mL | 1.99 mL | 3.99 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
