Loading distributor info...
| Description | Loureirin B, an essential component of Sanguis Draxonis, inhibits Kv1.3 channel and suppresses cytokine release from Jurkat T cells. |
|---|
| Catalog Num | A14849 |
|---|---|
| Formula | C18H20O5 |
| Molecular Weight | 316.35 |
| CAS Number | 119425-90-0 |
| SMILES | COC1=CC(=C(C(=C1)OC)CCC(=O)C2=CC=C(C=C2)O)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 97 mg/mL (306.62 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.61 mL | 158.05 mL | 316.11 mL |
| 0.5 mM | 6.32 mL | 31.61 mL | 63.22 mL |
| 1 mM | 3.16 mL | 15.81 mL | 31.61 mL |
| 5 mM | 0.63 mL | 3.16 mL | 6.32 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
