AhR agonist
Loading distributor info...
| Description | Norisoboldine, an alkaloid compound isolated from Radix Linderae, inhibits synovial angiogenesis in adjuvant-induced arthritis rats by moderating Notch1 pathway-related endothelial tip cell phenotype. |
|---|
| Catalog Num | A14721 |
|---|---|
| Formula | C18H19NO4 |
| Molecular Weight | 313.35 |
| CAS Number | 23599-69-1 |
| SMILES | COC1=C(C2=C3C(CC4=CC(=C(C=C42)OC)O)NCCC3=C1)O |
| Synonyms | (+)-N-Norisoboldine, (+)-Laurelliptine, (S)-(+)-Laurelliptine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (178.71 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.91 mL | 159.57 mL | 319.13 mL |
| 0.5 mM | 6.38 mL | 31.91 mL | 63.83 mL |
| 1 mM | 3.19 mL | 15.96 mL | 31.91 mL |
| 5 mM | 0.64 mL | 3.19 mL | 6.38 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
