Loading distributor info...
| Description | PFK-158 is an inhibitor of 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatases (PFK-2/FBPase) isoform 3 (PFKFB3) and derivative of 3-(3-pyridinyl)-1-[4-pyridinyl]-2-propen-1-one (3PO), with potential antineoplastic activity. |
|---|
| Catalog Num | A14398 |
|---|---|
| Formula | C18H11F3N2O |
| Molecular Weight | 328.29 |
| CAS Number | 1462249-75-7 |
| SMILES | O=C(C1=CC=NC=C1)/C=C/C2=NC3=CC(C(F)(F)F)=CC=C3C=C2 |
| Synonyms | PFK 158, PFK158, ACT-PEK-158 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 14 mg/mL (42.64 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 4 mg/mL (12.18 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.46 mL | 152.3 mL | 304.61 mL |
| 0.5 mM | 6.09 mL | 30.46 mL | 60.92 mL |
| 1 mM | 3.05 mL | 15.23 mL | 30.46 mL |
| 5 mM | 0.61 mL | 3.05 mL | 6.09 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
