Loading distributor info...
| Description | inhibits p53 binding to mitochondria by reducing its affinity for antiapoptotic proteins Bcl-2 and Bcl-XL. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12449 |
|---|---|
| Formula | C8H7NO2S |
| Molecular Weight | 181.21 |
| CAS Number | 64984-31-2 |
| SMILES | C1=CC=C(C=C1)C#CS(=O)(=O)N |
| Synonyms | NSC 303580 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 33 mg/mL (182.11 mM) | |
| Water | Insoluble | ||
| Ethanol | 33 mg/mL (182.11 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+ddH2O | 4 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 55.18 mL | 275.92 mL | 551.85 mL |
| 0.5 mM | 11.04 mL | 55.18 mL | 110.37 mL |
| 1 mM | 5.52 mL | 27.59 mL | 55.18 mL |
| 5 mM | 1.1 mL | 5.52 mL | 11.04 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
