Loading distributor info...
| Description | Proparacaine HCl is a voltage-gated sodium channels antagonist with ED50 of 3.4 mM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11715 |
|---|---|
| Formula | C16H26N2O3.HCl |
| Molecular Weight | 330.85 |
| CAS Number | CAS: 5875-06-9 |
| SMILES | CCCOC1=C(C=C(C=C1)C(=O)OCCN(CC)CC)N.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 12 mg/mL (36.27 mM) | |
| Water | 64 mg/mL (193.44 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | Saline | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.23 mL | 151.13 mL | 302.25 mL |
| 0.5 mM | 6.05 mL | 30.23 mL | 60.45 mL |
| 1 mM | 3.02 mL | 15.11 mL | 30.23 mL |
| 5 mM | 0.6 mL | 3.02 mL | 6.05 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
