Loading distributor info...
| Description | Tetrahydrozoline Hydrochloride is an alpha agonist which causes constriction of conjunctival blood vessels. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13080 |
|---|---|
| Formula | C13H16N2.HCl |
| Molecular Weight | 236.74 |
| CAS Number | 522-48-5 |
| SMILES | C1CC(C2=CC=CC=C2C1)C3=NCCN3.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 12 mg/mL (50.68 mM) | |
| Water | 46 mg/mL (194.31 mM) | ||
| Ethanol | 25 mg/mL (105.6 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.24 mL | 211.2 mL | 422.4 mL |
| 0.5 mM | 8.45 mL | 42.24 mL | 84.48 mL |
| 1 mM | 4.22 mL | 21.12 mL | 42.24 mL |
| 5 mM | 0.84 mL | 4.22 mL | 8.45 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
