Loading distributor info...
| Description | Thiamet G is a potent, selective O-GlcNAcase inhibitor with Kiof 21 nM, while exhibiting 37,000-fold selectivity over human lysosomal-hexosaminidase. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12895 |
|---|---|
| Formula | C9H16N2O4S |
| Molecular Weight | 248.3 |
| CAS Number | 1009816-48-1 |
| SMILES | CCNC1=NC2C(C(C(OC2S1)CO)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 47 mg/mL (189.28 mM) | |
| Water | 47 mg/mL (189.28 mM) | ||
| Ethanol | 11 mg/mL (44.29 mM) | ||
| In vivo | Saline | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.27 mL | 201.37 mL | 402.74 mL |
| 0.5 mM | 8.05 mL | 40.27 mL | 80.55 mL |
| 1 mM | 4.03 mL | 20.14 mL | 40.27 mL |
| 5 mM | 0.81 mL | 4.03 mL | 8.05 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
