Signaling Pathway
Memory-enhancing agent
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 1-BCP is a centrally active drug that modulates AMPA receptor gated currents. 1-BCP is a memory-enhancing agent. |
|---|
| Catalog Num | A20672 |
|---|---|
| Formula | C13H15NO3 |
| Molecular Weight | 233.26 |
| CAS Number | 34023-62-6 |
| SMILES | O=C(C1=CC=C(OCO2)C2=C1)N3CCCCC3 |
| Synonyms | Piperonylic acid piperidide |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 40 mg/mL (171.48 mM) | |
| Water | 5 mg/mL (21.43 mM) | ||
| Ethanol | 40 mg/mL (171.48 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.87 mL | 214.35 mL | 428.71 mL |
| 0.5 mM | 8.57 mL | 42.87 mL | 85.74 mL |
| 1 mM | 4.29 mL | 21.44 mL | 42.87 mL |
| 5 mM | 0.86 mL | 4.29 mL | 8.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
