Loading distributor info...
| Description | 2,4-Pyridinedicarboxylic Acid (2,4-PDCA) is an inhibitor of histone lysine-specific demethylases that targets on JMJD2A (KDM4A), KDM4C, KDM4E (IC50, 1.4 μM), KDM5B (IC50, 3 μM), KDM6A and other 2-oxogynases. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A16372 |
|---|---|
| Formula | C7H5NO4 |
| Molecular Weight | 167.12 |
| CAS Number | 499-80-9 |
| SMILES | O=C(O)C1=CC(C(O)=O)=NC=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 30 mg/mL (179.51 mM) | |
| Water | Insoluble | ||
| Ethanol | 19 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 59.84 mL | 299.19 mL | 598.37 mL |
| 0.5 mM | 11.97 mL | 59.84 mL | 119.67 mL |
| 1 mM | 5.98 mL | 29.92 mL | 59.84 mL |
| 5 mM | 1.2 mL | 5.98 mL | 11.97 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
