Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 3-Indolebutyric acid is a plant hormone in the auxin family and is an ingredient in many commercial horticultural plant rooting products. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10013 |
|---|---|
| Formula | C12H13NO2 |
| Molecular Weight | 203.2 |
| CAS Number | 133-32-4 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O |
| Synonyms | IBA |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 39 mg/mL (191.89 mM) | |
| Water | Insoluble | ||
| Ethanol | 39 mg/mL (191.89 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 49.21 mL | 246.06 mL | 492.13 mL |
| 0.5 mM | 9.84 mL | 49.21 mL | 98.43 mL |
| 1 mM | 4.92 mL | 24.61 mL | 49.21 mL |
| 5 mM | 0.98 mL | 4.92 mL | 9.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
