Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 4,4'-Dimethoxybenzil is a human intestinal carboxyl esterase (hiCE) inhibitor with Ki of 70 nM. |
|---|
| Catalog Num | A20145 |
|---|---|
| Formula | C16H14O4 |
| Molecular Weight | 270.28 |
| CAS Number | 1226-42-2 |
| SMILES | O=C(C1=CC=C(OC)C=C1)C(C2=CC=C(OC)C=C2)=O |
| Synonyms | p-Anisil |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (184.99 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37 mL | 184.99 mL | 369.99 mL |
| 0.5 mM | 7.4 mL | 37 mL | 74 mL |
| 1 mM | 3.7 mL | 18.5 mL | 37 mL |
| 5 mM | 0.74 mL | 3.7 mL | 7.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
