Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 4-Chloro-DL-phenylalanine is a selective and irreversible inhibitor of tryptophan hydroxylase, a rate-limiting enzyme in the biosynthesis of serotonin (5-HYDROXYTRYPTAMINE). |
|---|
| Catalog Num | A16424 |
|---|---|
| Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 |
| CAS Number | 7424-00-2 |
| SMILES | ClC1=CC=C(C=C1)C[C@H](C(O)=O)N |
| Synonyms | Fenclonine, PCPA, CP-10188 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 2 mg/mL (10.01 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 50.09 mL | 250.45 mL | 500.9 mL |
| 0.5 mM | 10.02 mL | 50.09 mL | 100.18 mL |
| 1 mM | 5.01 mL | 25.05 mL | 50.09 mL |
| 5 mM | 1 mL | 5.01 mL | 10.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
