Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 8-OH-DPAT is a potent and selective 5-HT agonist, with a pIC50 of 8.19 for 5-HT1A and a Ki of 466 nM for 5-HT7; 8-OH-DPAT weakly binds to 5-HT1B (pIC50, 5.42), 5-HT (pIC50 <5). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19261 |
|---|---|
| Formula | C16H25NO |
| Molecular Weight | 247.38 |
| CAS Number | 78950-78-4 |
| SMILES | OC1=C2CC(N(CCC)CCC)CCC2=CC=C1 |
| Synonyms | 8-Hydroxy-DPAT |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 46 mg/mL (185.94 mM) | |
| Water | Insoluble | ||
| Ethanol | 46 mg/mL (185.94 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.42 mL | 202.12 mL | 404.24 mL |
| 0.5 mM | 8.08 mL | 40.42 mL | 80.85 mL |
| 1 mM | 4.04 mL | 20.21 mL | 40.42 mL |
| 5 mM | 0.81 mL | 4.04 mL | 8.08 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
