Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | A-205804 is a potent and selective inhibitor of E-selectin and ICAM-1 with IC50 value of 20 nM and 25 nM, respectively. |
|---|
| Catalog Num | A13047 |
|---|---|
| Formula | C15H12N2OS2 |
| Molecular Weight | 300.39 |
| CAS Number | 251992-66-2 |
| SMILES | CC1=CC=C(C=C1)SC2=C3C=C(SC3=CN=C2)C(=O)N |
| Synonyms | A205804, A 205804 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (173.1 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.29 mL | 166.45 mL | 332.9 mL |
| 0.5 mM | 6.66 mL | 33.29 mL | 66.58 mL |
| 1 mM | 3.33 mL | 16.65 mL | 33.29 mL |
| 5 mM | 0.67 mL | 3.33 mL | 6.66 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
