Loading distributor info...
| Description | A-348441 is a selective glucocorticoid receptor antagonist that primarily targets the liver. This compound has been shown to effectively lower glucose levels in hepatic tissues. A-348441 is valuable for research into metabolic disorders, particularly in the study of type 2 diabetes and related metabolic diseases. |
|---|
| Catalog Num | A64787 |
|---|---|
| Formula | C54H75NO7 |
| Molecular Weight | 850.18 |
| CAS Number | 639520-46-0 |
| SMILES | C[C@@]12[C@](CC[C@@]2(O)C#CC)([H])[C@@]3([H])C([C@@H](C4=CC=C(N(C)CCO[C@@H]5C[C@]6([H])[C@@](C)([C@]7([H])[C@@]([C@@]8([H])[C@@](C)([C@]([C@H](C)CCC(O)=O)([H])CC8)[C@@H](O)C7)([H])[C@H](O)C6)CC5)C=C4)C1)=C9C(CC3)=CC(CC9)=O |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
