Loading distributor info...
| Description | A-366 is a potent and selective G9a/GLP histone lysine methyltransferase inhibitor with IC50 value of 3.3 nM. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A15969 |
|---|---|
| Formula | C19H27N3O2 |
| Molecular Weight | 329.44 |
| CAS Number | 1527503-11-2 |
| SMILES | NC1=NC2=CC(OCCCN3CCCC3)=C(OC)C=C2C14CCC4 |
| Synonyms | A366, A366 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (188.19 mM) | |
| Water | Insoluble | ||
| Ethanol | 62 mg/mL (188.19 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.35 mL | 151.77 mL | 303.55 mL |
| 0.5 mM | 6.07 mL | 30.35 mL | 60.71 mL |
| 1 mM | 3.04 mL | 15.18 mL | 30.35 mL |
| 5 mM | 0.61 mL | 3.04 mL | 6.07 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
