Loading distributor info...
| Description | Actarit is a drug that has been shown to suppress disease activity of rheumatoid arthritis (RA). Actarit reduces spontaneous tumor necrosis factor-alpha and interleukin 1beta secretion by primary synovial cells of patients with RA. |
|---|
| Catalog Num | A17497 |
|---|---|
| Formula | C10H11NO3 |
| Molecular Weight | 193.2 |
| CAS Number | 18699-02-0 |
| SMILES | O=C(O)CC1=CC=C(NC(C)=O)C=C1 |
| Synonyms | Actarit; NSC 170317; NSC-170317; NSC170317 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 33 mg/mL (170.8 mM) | |
| Ethanol | <1 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 51.76 mL | 258.8 mL | 517.6 mL |
| 0.5 mM | 10.35 mL | 51.76 mL | 103.52 mL |
| 1 mM | 5.18 mL | 25.88 mL | 51.76 mL |
| 5 mM | 1.04 mL | 5.18 mL | 10.35 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
