Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AdipoRon is a novel small-molecule AdipoR agonist; binds to both AdipoR1(Kd= 1.8 uM) and AdipoR2(Kd=3.1 uM). IC50 value: 1.8/3.1 uM(AdipoR1/2, Kd) | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13768 |
|---|---|
| Formula | C27H28N2O3 |
| Molecular Weight | 428.52 |
| CAS Number | 924416-43-3 |
| SMILES | C1CN(CCC1NC(=O)COC2=CC=C(C=C2)C(=O)C3=CC=CC=C3)CC4=CC=CC=C4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (179.69 mM) | |
| Water | Insoluble | ||
| Ethanol | 45 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.34 mL | 116.68 mL | 233.36 mL |
| 0.5 mM | 4.67 mL | 23.34 mL | 46.67 mL |
| 1 mM | 2.33 mL | 11.67 mL | 23.34 mL |
| 5 mM | 0.47 mL | 2.33 mL | 4.67 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
