Loading distributor info...
| Description | Adjudin is a drug which is under development as a potential non-hormonal male contraceptive drug, which acts by blocking the production of sperm in the testes, but without affecting testosterone production. |
|---|
| Catalog Num | A16303 |
|---|---|
| Formula | C15H12Cl2N4O |
| Molecular Weight | 335.19 |
| CAS Number | 252025-52-8 |
| SMILES | O=C(C1=NN(CC2=CC=C(Cl)C=C2Cl)C3=C1C=CC=C3)NN |
| Synonyms | AF-2364, AF 2364, AF2364 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (184.96 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (5.96 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.83 mL | 149.17 mL | 298.34 mL |
| 0.5 mM | 5.97 mL | 29.83 mL | 59.67 mL |
| 1 mM | 2.98 mL | 14.92 mL | 29.83 mL |
| 5 mM | 0.6 mL | 2.98 mL | 5.97 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
