Loading distributor info...
| Description | AG-126 is a ERK2 inhibitor that selectively inhibits the phosphorylation of ERK1 (p44) and ERK2 (p42) at 25-50 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17146 |
|---|---|
| Formula | C10H5N3O3 |
| Molecular Weight | 215.2 |
| CAS Number | 118409-62-4 |
| SMILES | OC1=C([N+]([O-])=O)C=CC(/C=C(C#N)\C#N)=C1 |
| Synonyms | AG126, AG 126, Tyrphostin AG-126 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 37 mg/mL (171.96 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (9.29 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.47 mL | 232.34 mL | 464.68 mL |
| 0.5 mM | 9.29 mL | 46.47 mL | 92.94 mL |
| 1 mM | 4.65 mL | 23.23 mL | 46.47 mL |
| 5 mM | 0.93 mL | 4.65 mL | 9.29 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
