Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AHR antagonist 1 is an aryl hydrocarbon receptor (AHR) antagonist extracted from patent WO2017202816A1, example 23, has an IC50 of 39.9 nM in human cell line. |
|---|
| Catalog Num | A19881 |
|---|---|
| Formula | C20H17ClFN3O3 |
| Molecular Weight | 401.82 |
| CAS Number | 2162982-11-6 |
| SMILES | O=C(C1=CC(C2=CC=C(Cl)C=C2)=NN(C3=CC=CC(F)=C3)C1=O)N[C@@H](C)CO |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (189.14 mM) | |
| Water | Insoluble | ||
| Ethanol | 19 mg/mL (47.28 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.89 mL | 124.43 mL | 248.87 mL |
| 0.5 mM | 4.98 mL | 24.89 mL | 49.77 mL |
| 1 mM | 2.49 mL | 12.44 mL | 24.89 mL |
| 5 mM | 0.5 mL | 2.49 mL | 4.98 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
