Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Alobresib (GS-5829) is a BET bromodomain inhibitor, which represents a highly effective therapeutics agent against recurrent/chemotherapy resistant uterine serous carcinoma (USC) overexpressing c-Myc. |
|---|
| Catalog Num | A19246 |
|---|---|
| Formula | C26H23N5O2 |
| Molecular Weight | 437.49 |
| CAS Number | 1637771-14-2 |
| SMILES | OC(C1=CC=CC=N1)(C2=CC=CC=N2)C3=C(NC(C4CC4)=N5)C5=CC(C(C(C)=NO6)=C6C)=C3 |
| Synonyms | GS-5829, GS 5829, GS5829 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (173.72 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 10 mg/mL (22.85 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.86 mL | 114.29 mL | 228.58 mL |
| 0.5 mM | 4.57 mL | 22.86 mL | 45.72 mL |
| 1 mM | 2.29 mL | 11.43 mL | 22.86 mL |
| 5 mM | 0.46 mL | 2.29 mL | 4.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
