Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Alprenolol (hydrochloride) is a non-selective beta blocker as well as 5-HT1A receptor antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17781 |
|---|---|
| Formula | C15H24ClNO2 |
| Molecular Weight | 285.81 |
| CAS Number | 13707-88-5 |
| SMILES | OC(COC1=CC=CC=C1CC=C)CNC(C)C.[H]Cl |
| Synonyms | Alprenolol hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (174.94 mM) | |
| Water | 50 mg/mL (174.94 mM) | ||
| Ethanol | 50 mg/mL (174.94 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.99 mL | 174.94 mL | 349.88 mL |
| 0.5 mM | 7 mL | 34.99 mL | 69.98 mL |
| 1 mM | 3.5 mL | 17.49 mL | 34.99 mL |
| 5 mM | 0.7 mL | 3.5 mL | 7 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
