Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Amcasertib (BBI503), a first-in-class cancer stemness kinase inhibitor, is claimed to inhibit Nanog and other CSC pathways by targeting kinases with potential anticancer activity. |
|---|
| Catalog Num | A16850 |
|---|---|
| Formula | C31H33N5O2S |
| Molecular Weight | 539.69 |
| CAS Number | 1129403-56-0 |
| SMILES | O=C(C1=C(C)NC(/C=C2C(NC3=C/2C=C(C4=CSC(C5=CC=CC=C5)=N4)C=C3)=O)=C1C)NCCN(CC)CC |
| Synonyms | BBI 503, BBI-503 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 14 mg/mL (25.94 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (1.85 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.53 mL | 92.65 mL | 185.29 mL |
| 0.5 mM | 3.71 mL | 18.53 mL | 37.06 mL |
| 1 mM | 1.85 mL | 9.26 mL | 18.53 mL |
| 5 mM | 0.37 mL | 1.85 mL | 3.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
