Loading distributor info...
| Description | AMG 487 is an orally active and selective antagonist of CXC chemokine receptor 3 (CXCR3) which inhibits the binding of CXCL10 and CXCL11 to CXCR3 with IC50s of 8.0 and 8.2 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21162 |
|---|---|
| Formula | C32H28F3N5O4 |
| Molecular Weight | 603.59 |
| CAS Number | 473719-41-4 |
| SMILES | O=C(N([C@@H](C1=NC2=NC=CC=C2C(N1C3=CC=C(OCC)C=C3)=O)C)CC4=CC=CN=C4)CC5=CC=C(OC(F)(F)F)C=C5 |
| Synonyms | AMG-487, AMG487 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 97 mg/mL (160.7 mM) | |
| Water | Insoluble | ||
| Ethanol | 97 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.57 mL | 82.84 mL | 165.68 mL |
| 0.5 mM | 3.31 mL | 16.57 mL | 33.14 mL |
| 1 mM | 1.66 mL | 8.28 mL | 16.57 mL |
| 5 mM | 0.33 mL | 1.66 mL | 3.31 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
