Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Amprenavir is an human immunodeficiency virus (HIV) protease inhibitor with IC50 of 14.6 ?? 12.5 ng/ml for wild-type HIV isolates | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11985 |
|---|---|
| Formula | C25H35N3O6S |
| Molecular Weight | 505.63 |
| CAS Number | 161814-49-9 |
| SMILES | CC(C)CN(C[C@H]([C@H](CC1=CC=CC=C1)NC(=O)O[C@H]2CCOC2)O)S(=O)(=O)C3=CC=C(C=C3)N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 15 mg/mL (29.66 mM) | |
| Water | Insoluble | ||
| Ethanol | 91 mg/mL (179.97 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.78 mL | 98.89 mL | 197.77 mL |
| 0.5 mM | 3.96 mL | 19.78 mL | 39.55 mL |
| 1 mM | 1.98 mL | 9.89 mL | 19.78 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
