Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Apremilast, a novel PDE4 inhibitor, inhibits spontaneous production of tumour necrosis factor-alpha from human rheumatoid synovial cells and ameliorates experimental arthritis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11289 |
|---|---|
| Formula | C22H24N2O7S |
| Molecular Weight | 460.5 |
| CAS Number | 608141-41-9 |
| SMILES | CCOC1=C(C=CC(=C1)[C@@H](CS(=O)(=O)C)N2C(=O)C3=C(C2=O)C(=CC=C3)NC(=O)C)OC |
| Synonyms | CC10004, CC-10004 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 85 mg/mL (184.58 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% CMC+0.25% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.72 mL | 108.58 mL | 217.16 mL |
| 0.5 mM | 4.34 mL | 21.72 mL | 43.43 mL |
| 1 mM | 2.17 mL | 10.86 mL | 21.72 mL |
| 5 mM | 0.43 mL | 2.17 mL | 4.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
