Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Arctiin has shown to be a suppressor of cyclin D1 protein expression in multiple types of human tumor cells, such as osteosarcoma, lung, colorectal, cervical, breast, melanoma, and prostate cancer |
|---|
| Catalog Num | A12019 |
|---|---|
| Formula | C27H34O11 |
| Molecular Weight | 534.55 |
| CAS Number | 20362-31-6 |
| SMILES | COC1=C(C=C(C=C1)C[C@H]2COC(=O)[C@@H]2CC3=CC(=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC)OC |
| Synonyms | Arctigenin-4-glucoside |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 96 mg/mL (179.59 mM) | |
| Water | 38 mg/mL (71.08 mM) | ||
| Ethanol | 96 mg/mL (179.59 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.71 mL | 93.54 mL | 187.07 mL |
| 0.5 mM | 3.74 mL | 18.71 mL | 37.41 mL |
| 1 mM | 1.87 mL | 9.35 mL | 18.71 mL |
| 5 mM | 0.37 mL | 1.87 mL | 3.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
