Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Argatroban is an anticoagulant that is a small molecule direct thrombin inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11774 |
|---|---|
| Formula | C23H36N6O5S |
| Molecular Weight | 508.6 |
| CAS Number | 74863-84-6 |
| SMILES | C[C@@H]1CCN([C@H](C1)C(=O)O)C(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)C2=CC=CC3=C2NCC(C3)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 8 mg/mL (15.72 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (9.83 mM) | ||
| In vivo | 2% DMSO+40% PEG 300+2% Tween 80+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.66 mL | 98.31 mL | 196.62 mL |
| 0.5 mM | 3.93 mL | 19.66 mL | 39.32 mL |
| 1 mM | 1.97 mL | 9.83 mL | 19.66 mL |
| 5 mM | 0.39 mL | 1.97 mL | 3.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
