Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AS-605240 is an orally active inhibitor of PI3-kinase γ that inhibits human recombinant PI3Kγ, α, β, and δ in an ATP-competitive manner with IC50 values of 8, 60, 270, and 300 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10088 |
|---|---|
| Formula | C12H7N3O2S |
| Molecular Weight | 257.3 |
| CAS Number | 648450-29-7 |
| SMILES | C1=CC2=NC=CN=C2C=C1/C=C\3/C(=O)NC(=O)S3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 0.38 mg/mL (1.47 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% CMC+0.25% Tween 80 | 10 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.87 mL | 194.33 mL | 388.65 mL |
| 0.5 mM | 7.77 mL | 38.87 mL | 77.73 mL |
| 1 mM | 3.89 mL | 19.43 mL | 38.87 mL |
| 5 mM | 0.78 mL | 3.89 mL | 7.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
