Loading distributor info...
| Description | Avapritinib (BLU-285) is a highly potent, selective, and orally bioavailable KIT and PDGFRA activation loop mutant kinases inhibitor with IC50s of 0.27 and 0.24 nM for KIT D816V and PDGFRA D842V, respectively. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A19505 |
|---|---|
| Formula | C26H27FN10 |
| Molecular Weight | 498.56 |
| CAS Number | 1703793-34-3 |
| SMILES | CN1N=CC(C2=CN3C(C(N4CCN(C5=NC=C([C@@](C)(N)C6=CC=C(F)C=C6)C=N5)CC4)=NC=N3)=C2)=C1 |
| Synonyms | BLU-285, BLU 285, BLU285 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 61 mg/mL (122.35 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL | ||
| In vivo | 2% DMSO+40% PEG 300+2% Tween 80+ddH2O | 3 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.06 mL | 100.29 mL | 200.58 mL |
| 0.5 mM | 4.01 mL | 20.06 mL | 40.12 mL |
| 1 mM | 2.01 mL | 10.03 mL | 20.06 mL |
| 5 mM | 0.4 mL | 2.01 mL | 4.01 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
