Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AWD 131-138 is a new low-affinity partial benzodiazepine receptor agonist with potent anticonvulsant and anxiolytic properties in rodent models. |
|---|
| Catalog Num | A13726 |
|---|---|
| Formula | C13H14ClN3O2 |
| Molecular Weight | 279.72 |
| CAS Number | 188116-07-6 |
| SMILES | C1COCCN1C2=NC(=O)N(C2)C3=CC=C(C=C3)Cl |
| Synonyms | AWD-131-138, AWD131-138, Imepitoin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 28 mg/mL (100.1 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.75 mL | 178.75 mL | 357.5 mL |
| 0.5 mM | 7.15 mL | 35.75 mL | 71.5 mL |
| 1 mM | 3.58 mL | 17.88 mL | 35.75 mL |
| 5 mM | 0.72 mL | 3.58 mL | 7.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
