Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Axitinib is a small molecule tyrosine kinase inhibitor,which inhibits multiple targets, including VEGFR-1, VEGFR-2, VEGFR-3, platelet derived growth factor receptor (PDGFR), and cKIT (CD117). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10103 |
|---|---|
| Formula | C22H18N4OS |
| Molecular Weight | 386.5 |
| CAS Number | 319460-85-0 |
| SMILES | CNC(=O)C1=CC=CC=C1SC2=CC3=C(C=C2)C(=NN3)/C=C/C4=CC=CC=N4 |
| Synonyms | AG 013736 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 30 mg/mL (77.62 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.87 mL | 129.37 mL | 258.73 mL |
| 0.5 mM | 5.17 mL | 25.87 mL | 51.75 mL |
| 1 mM | 2.59 mL | 12.94 mL | 25.87 mL |
| 5 mM | 0.52 mL | 2.59 mL | 5.17 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
