Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD-5991 Racemate is the racemate of AZD-5991. AZD-5991 Racemate is a Mcl-1 inhibitor with an IC50 of <3 nM in FRET assay. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21357 |
|---|---|
| Formula | C35H34ClN5O3S2 |
| Molecular Weight | 672.26 |
| CAS Number | 2143010-83-5 |
| SMILES | O=C(O)C1=C(CCCOC2=C(C=CC=C3)C3=CC4=C2)C5=C(N1C)C(C6=C(C)N(C)N=C6CSCC7=NN(C)C(CS4)=C7)=C(Cl)C=C5 |
| Synonyms | AZD 5991, AZD5991 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (136.85 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.88 mL | 74.38 mL | 148.75 mL |
| 0.5 mM | 2.98 mL | 14.88 mL | 29.75 mL |
| 1 mM | 1.49 mL | 7.44 mL | 14.88 mL |
| 5 mM | 0.3 mL | 1.49 mL | 2.98 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
