Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD2858 is a selective GSK-3 inhibitor with an IC50 of 68 nM, activating Wnt signaling, increases bone mass in rats. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13060 |
|---|---|
| Formula | C21H23N7O3S |
| Molecular Weight | 453.52 |
| CAS Number | 486424-20-8 |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)C3=CN=C(C(=N3)C(=O)NC4=CN=CC=C4)N |
| Synonyms | AZD-2858, AZD 2858 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 6 mg/mL (13.23 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.05 mL | 110.25 mL | 220.5 mL |
| 0.5 mM | 4.41 mL | 22.05 mL | 44.1 mL |
| 1 mM | 2.2 mL | 11.02 mL | 22.05 mL |
| 5 mM | 0.44 mL | 2.2 mL | 4.41 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
