Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD3229 is a potent pan-KIT mutant inhibitor for the treatment of gastrointestinal stromal tumors. |
|---|
| Catalog Num | A19259 |
|---|---|
| Formula | C24H26FN7O3 |
| Molecular Weight | 479.51 |
| CAS Number | 2248003-60-1 |
| SMILES | COCCOC1=CC(F)=C2C(N=CN=C2NC3=CC=C(NC(CN4C=C(C(C)C)N=N4)=O)C=C3)=C1 |
| Synonyms | AZD 3229, AZD-3229 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 94 mg/mL (196.03 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.85 mL | 104.27 mL | 208.55 mL |
| 0.5 mM | 4.17 mL | 20.85 mL | 41.71 mL |
| 1 mM | 2.09 mL | 10.43 mL | 20.85 mL |
| 5 mM | 0.42 mL | 2.09 mL | 4.17 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
