Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Azelastine is a potent, second-generation, selective, histamine antagonist (histamine-H1-receptor antagonist). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10117 |
|---|---|
| Formula | C22H24ClN3O.HCl |
| Molecular Weight | 418.4 |
| CAS Number | 79307-93-0 |
| SMILES | CN1CCCC(CC1)N2C(=O)C3=CC=CC=C3C(=N2)CC4=CC=C(C=C4)Cl.Cl |
| Synonyms | Rhinolast, Astelin, Optilas, Optivar |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 27 mg/mL (64.53 mM) | |
| Water | 78 mg/mL (186.42 mM) | ||
| Ethanol | 78 mg/mL (186.42 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.9 mL | 119.5 mL | 239.01 mL |
| 0.5 mM | 4.78 mL | 23.9 mL | 47.8 mL |
| 1 mM | 2.39 mL | 11.95 mL | 23.9 mL |
| 5 mM | 0.48 mL | 2.39 mL | 4.78 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
