Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Baohuoside I is an effective anti-cancer drug currently used for a variety of cancers in vitro. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14765 |
|---|---|
| Formula | C27H30O10 |
| Molecular Weight | 514.52 |
| CAS Number | 113558-15-9 |
| SMILES | CC1C(C(C(C(O1)OC2=C(OC3=C(C2=O)C(=CC(=C3CC=C(C)C)O)O)C4=CC=C(C=C4)OC)O)O)O |
| Synonyms | Icariin II, Icariside II |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (176.86 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.44 mL | 97.18 mL | 194.36 mL |
| 0.5 mM | 3.89 mL | 19.44 mL | 38.87 mL |
| 1 mM | 1.94 mL | 9.72 mL | 19.44 mL |
| 5 mM | 0.39 mL | 1.94 mL | 3.89 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
