Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BAY-1251152, also known as (+)-BAY-1251152, is a CDK9 inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17029 |
|---|---|
| Formula | C19H18F2N4O2S |
| Molecular Weight | 404.43 |
| CAS Number | 1610358-56-9 |
| SMILES | N=S(CC1=CC(NC2=NC=C(F)C(C3=CC=C(F)C=C3OC)=C2)=NC=C1)(C)=O |
| Synonyms | BAY 1251152, BAY1251152 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (175.55 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.73 mL | 123.63 mL | 247.26 mL |
| 0.5 mM | 4.95 mL | 24.73 mL | 49.45 mL |
| 1 mM | 2.47 mL | 12.36 mL | 24.73 mL |
| 5 mM | 0.49 mL | 2.47 mL | 4.95 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
