Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BAY-1436032 is a potent, selective and orally available inhibitor of mutant Isocitrate Dehydrogenase 1 (mIDH1). |
|---|
| Catalog Num | A17059 |
|---|---|
| Formula | C26H30F3N3O3 |
| Molecular Weight | 489.54 |
| CAS Number | 1803274-65-8 |
| SMILES | O=C(O)CCC1=CC=C2N([C@H]3CC(C)(C)C[C@@H](C)C3)C(NC4=CC=C(OC(F)(F)F)C=C4)=NC2=C1 |
| Synonyms | BAY1436032, BAY 1436032 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (173.63 mM) | |
| Water | Insoluble | ||
| Ethanol | 85 mg/mL (173.63 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.43 mL | 102.14 mL | 204.27 mL |
| 0.5 mM | 4.09 mL | 20.43 mL | 40.85 mL |
| 1 mM | 2.04 mL | 10.21 mL | 20.43 mL |
| 5 mM | 0.41 mL | 2.04 mL | 4.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
