Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BAY-1895344 is a potent, orally available and selective ATR inhibitor, with IC50 of 7 nM. Anti-tumor activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19454 |
|---|---|
| Formula | C20H21N7O |
| Molecular Weight | 375.43 |
| CAS Number | 1876467-74-1 |
| SMILES | CN1N=CC=C1C2=CC(N3[C@H](C)COCC3)=NC4=C(C5=NNC=C5)N=CC=C24 |
| Synonyms | BAY1895344, BAY 1895344 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 80 mg/mL (194.22 mM) | |
| Water | 80 mg/mL (194.22 mM) | ||
| Ethanol | 80 mg/mL (194.22 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.64 mL | 133.18 mL | 266.36 mL |
| 0.5 mM | 5.33 mL | 26.64 mL | 53.27 mL |
| 1 mM | 2.66 mL | 13.32 mL | 26.64 mL |
| 5 mM | 0.53 mL | 2.66 mL | 5.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
