Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BAY-293 is a potent, cell-active SOS1 inhibitor that disrupts the KRAS-SOS1 interaction with IC50 of 21 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18319 |
|---|---|
| Formula | C25H28N4O2S |
| Molecular Weight | 448.59 |
| CAS Number | 2244904-70-7 |
| SMILES | CNCC1=C(C=CC=C1)C1=CSC(=C1)[C@@H](C)NC1=NC(C)=NC2=C1C=C(OC)C(OC)=C2 |
| Synonyms | BAY293, BAY-293 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (196.17 mM) | |
| Water | Insoluble | ||
| Ethanol | 88 mg/mL (196.17 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.29 mL | 111.46 mL | 222.92 mL |
| 0.5 mM | 4.46 mL | 22.29 mL | 44.58 mL |
| 1 mM | 2.23 mL | 11.15 mL | 22.29 mL |
| 5 mM | 0.45 mL | 2.23 mL | 4.46 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
