Loading distributor info...
| Description | BAY-8002 is a potent, selective, orally active inhibitor of monocarboxylate transporter 1 (MCT1), with an IC50 of 85 nM in the MCT1-expressing DLD-1 cells, displays excellent selectivity against MCT4. Anti-tumor activity. |
|---|
| Catalog Num | A18611 |
|---|---|
| Formula | C20H14ClNO5S |
| Molecular Weight | 415.85 |
| CAS Number | 724440-27-1 |
| SMILES | O=C(O)C1=CC=CC=C1NC(C2=CC(S(=O)(C3=CC=CC=C3)=O)=CC=C2Cl)=O |
| Synonyms | BAY8002, BAY 8002 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 73 mg/mL (175.54 mM) | |
| Water | Insoluble | ||
| Ethanol | 25 mg/mL (60.12 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.05 mL | 120.24 mL | 240.47 mL |
| 0.5 mM | 4.81 mL | 24.05 mL | 48.09 mL |
| 1 mM | 2.4 mL | 12.02 mL | 24.05 mL |
| 5 mM | 0.48 mL | 2.4 mL | 4.81 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
