Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Belvarafenib (HM95573) is a potent and pan RAF (Rapidly Accelerated Fibrosarcoma) inhibitor, with IC50s of 56 nM, 7 nM and 5 nM for B-RAF, B-RAFv600E and C-RAF respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13177 |
|---|---|
| Formula | C23H16ClFN6OS |
| Molecular Weight | 478.93 |
| CAS Number | 1446113-23-0 |
| SMILES | O=C(C(C1=NC=N2)=CSC1=C2N)NC(C3=C4C(NC(C=CC=C5Cl)=C5F)=NC=C3)=C(C=C4)C |
| Synonyms | HM 95573, HM-95573, HM95573; GDC-5573, GDC5573, GDC 5573; RG6185, RG 6185, RG-6185 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 84 mg/mL (175.39 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.88 mL | 104.4 mL | 208.8 mL |
| 0.5 mM | 4.18 mL | 20.88 mL | 41.76 mL |
| 1 mM | 2.09 mL | 10.44 mL | 20.88 mL |
| 5 mM | 0.42 mL | 2.09 mL | 4.18 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
