Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Benfotiamine is a synthetic S-acyl derivative of thiamine (vitamin B1), an antioxidant dietary supplement. |
|---|
| Catalog Num | A15020 |
|---|---|
| Formula | C19H23N4O6PS |
| Molecular Weight | 466.45 |
| CAS Number | 22457-89-2 |
| SMILES | CC1=NC=C(C(=N1)N)CN(C=O)C(=C(CCOP(=O)(O)O)SC(=O)C2=CC=CC=C2)C |
| Synonyms | S-Benzoylthiamine O-monophosphate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 0.01 mg/mL (0.02 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.44 mL | 107.19 mL | 214.39 mL |
| 0.5 mM | 4.29 mL | 21.44 mL | 42.88 mL |
| 1 mM | 2.14 mL | 10.72 mL | 21.44 mL |
| 5 mM | 0.43 mL | 2.14 mL | 4.29 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
