Loading distributor info...
| Description | Bergaptol is a hydroxylated psoralen that acts as a potent inhibitors of debenzylation activity of CYP3A4 enzyme with an IC50 value of 24.92 uM. Recent studies suggest that it may have antiproliferative and anticancer properties. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A12303 |
|---|---|
| Formula | C11H6O4 |
| Molecular Weight | 202.16 |
| CAS Number | 486-60-2 |
| SMILES | O=C1C=CC(C(O1)=C2)=C(O)C3=C2OC=C3 |
| Synonyms | 5-Hydroxypsoralen; 4-Hydroxybergapten |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 38 mg/mL (187.97 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 49.47 mL | 247.33 mL | 494.66 mL |
| 0.5 mM | 9.89 mL | 49.47 mL | 98.93 mL |
| 1 mM | 4.95 mL | 24.73 mL | 49.47 mL |
| 5 mM | 0.99 mL | 4.95 mL | 9.89 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
