Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BIBF1120 (Vargatef) is a novel triple angiokinase inhibitor that inhibits three growth factor receptors simultaneously: VEGFR, PDGF and FGFR. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10137 |
|---|---|
| Formula | C31H33N5O4 |
| Molecular Weight | 539.6 |
| CAS Number | 928326-83-4, 656247-17-5 |
| SMILES | CN1CCN(CC1)CC(=O)N(C)C2=CC=C(C=C2)N/C(=C\3/C4=C(C=C(C=C4)C(=O)OC)NC3=O)/C5=CC=CC=C5 |
| Synonyms | Vargatef |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 6 mg/mL (11.11 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (5.55 mM) | ||
| In vivo | 5% DMSO+40% PEG 300+2% Tween 80+ddH2O | 0.23 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.53 mL | 92.66 mL | 185.32 mL |
| 0.5 mM | 3.71 mL | 18.53 mL | 37.06 mL |
| 1 mM | 1.85 mL | 9.27 mL | 18.53 mL |
| 5 mM | 0.37 mL | 1.85 mL | 3.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
