Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BML-190 is a selective inverse agonist of the human cannabinoid CB2 receptor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11938 |
|---|---|
| Formula | C23H23ClN2O4 |
| Molecular Weight | 426.9 |
| CAS Number | 2854-32-2 |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)N4CCOCC4 |
| Synonyms | BML190 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 21 mg/mL (49.19 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.42 mL | 117.12 mL | 234.25 mL |
| 0.5 mM | 4.68 mL | 23.42 mL | 46.85 mL |
| 1 mM | 2.34 mL | 11.71 mL | 23.42 mL |
| 5 mM | 0.47 mL | 2.34 mL | 4.68 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
