Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BMS-813160 is a potent and selective CCR2/CCR5 antagonist with potential immunomodulating and antineoplastic activities. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17040 |
|---|---|
| Formula | C25H40N8O2 |
| Molecular Weight | 484.65 |
| CAS Number | 1286279-29-5 |
| SMILES | CC(N[C@H]1[C@@H](N2C([C@@H](NC3=NC=NC4=CC(C(C)(C)C)=NN43)CC2)=O)CC[C@@H](NC(C)(C)C)C1)=O |
| Synonyms | BMS813160, BMS 813160 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (189.82 mM) | |
| Water | Insoluble | ||
| Ethanol | 92 mg/mL (189.82 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.63 mL | 103.17 mL | 206.33 mL |
| 0.5 mM | 4.13 mL | 20.63 mL | 41.27 mL |
| 1 mM | 2.06 mL | 10.32 mL | 20.63 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
